C19H44N2O7Si2 — CID 173175803
1,1-bis(1,1,2-triethoxy-3-silylpropyl)urea (PubChem CID 173175803) has the molecular formula C19H44N2O7Si2 and a molecular weight of 468.74 g/mol. Its IUPAC name is 1,1-bis(1,1,2-triethoxy-3-silylpropyl)urea.
| Compound Name | 1,1-bis(1,1,2-triethoxy-3-silylpropyl)urea |
|---|---|
| PubChem CID | 173175803 |
| Molecular Formula | C19H44N2O7Si2 |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1,1-bis(1,1,2-triethoxy-3-silylpropyl)urea |
| SMILES | CCOC(C[SiH3])C(OCC)(OCC)N(C(N)=O)C(OCC)(OCC)C(C[SiH3])OCC |
| InChI | InChI=1S/C19H44N2O7Si2/c1-7-23-15(13-29)18(25-9-3,26-10-4)21(17(20)22)19(27-11-5,28-12-6)16(14-30)24-8-2/h15-16H,7-14H2,1-6,29-30H3,(H2,20,22) |
| InChIKey | QQUDMRLFPHGKLG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|