C13H24O6Si — CID 173389206
3-(1,1,2-triethoxy-3-silylpropyl)oxolane-2,5-dione (PubChem CID 173389206) has the molecular formula C13H24O6Si and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-(1,1,2-triethoxy-3-silylpropyl)oxolane-2,5-dione.
| Compound Name | 3-(1,1,2-triethoxy-3-silylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 173389206 |
| Molecular Formula | C13H24O6Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(1,1,2-triethoxy-3-silylpropyl)oxolane-2,5-dione |
| SMILES | CCOC(C[SiH3])C(OCC)(OCC)C1CC(=O)OC1=O |
| InChI | InChI=1S/C13H24O6Si/c1-4-16-10(8-20)13(17-5-2,18-6-3)9-7-11(14)19-12(9)15/h9-10H,4-8H2,1-3,20H3 |
| InChIKey | FIVDZNMBSRFYCQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|