C7H12O3Si — CID 173422066
3-(1-silylpropyl)oxolane-2,5-dione (PubChem CID 173422066) has the molecular formula C7H12O3Si and a molecular weight of 172.26 g/mol. Its IUPAC name is 3-(1-silylpropyl)oxolane-2,5-dione.
| Compound Name | 3-(1-silylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 173422066 |
| Molecular Formula | C7H12O3Si |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3-(1-silylpropyl)oxolane-2,5-dione |
| SMILES | CCC([SiH3])C1CC(=O)OC1=O |
| InChI | InChI=1S/C7H12O3Si/c1-2-5(11)4-3-6(8)10-7(4)9/h4-5H,2-3H2,1,11H3 |
| InChIKey | NXNFZHRYWOJOQO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|