C21H30O6 — CID 157064477
3-hept-1-en-3-yloxolane-2,5-dione;3-hex-1-en-3-yloxolane-2,5-dione (PubChem CID 157064477) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-hept-1-en-3-yloxolane-2,5-dione;3-hex-1-en-3-yloxolane-2,5-dione.
| Compound Name | 3-hept-1-en-3-yloxolane-2,5-dione;3-hex-1-en-3-yloxolane-2,5-dione |
|---|---|
| PubChem CID | 157064477 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-hept-1-en-3-yloxolane-2,5-dione;3-hex-1-en-3-yloxolane-2,5-dione |
| SMILES | C=CC(CCC)C1CC(=O)OC1=O.C=CC(CCCC)C1CC(=O)OC1=O |
| InChI | InChI=1S/C11H16O3.C10H14O3/c1-3-5-6-8(4-2)9-7-10(12)14-11(9)13;1-3-5-7(4-2)8-6-9(11)13-10(8)12/h4,8-9H,2-3,5-7H2,1H3;4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | ABSFOAMTMLOUAZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|