C17H26O4 — CID 90440247
3-[(E)-12-oxotridec-2-en-4-yl]oxolane-2,5-dione (PubChem CID 90440247) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-[(E)-12-oxotridec-2-en-4-yl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-12-oxotridec-2-en-4-yl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 90440247 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-[(E)-12-oxotridec-2-en-4-yl]oxolane-2,5-dione |
| SMILES | C/C=C/C(CCCCCCCC(C)=O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C17H26O4/c1-3-9-14(15-12-16(19)21-17(15)20)11-8-6-4-5-7-10-13(2)18/h3,9,14-15H,4-8,10-12H2,1-2H3/b9-3+ |
| InChIKey | QQZNSFRABNCBPQ-YCRREMRBSA-N |
| XLogP | 3.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|