C22H36O5 — CID 72559719
9-(2,5-dioxooxolan-3-yl)octadec-10-enoic acid (PubChem CID 72559719) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is 9-(2,5-dioxooxolan-3-yl)octadec-10-enoic acid.
| Compound Name | 9-(2,5-dioxooxolan-3-yl)octadec-10-enoic acid |
|---|---|
| PubChem CID | 72559719 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 9-(2,5-dioxooxolan-3-yl)octadec-10-enoic acid |
| SMILES | CCCCCCCC=CC(CCCCCCCC(=O)O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C22H36O5/c1-2-3-4-5-6-8-11-14-18(19-17-21(25)27-22(19)26)15-12-9-7-10-13-16-20(23)24/h11,14,18-19H,2-10,12-13,15-17H2,1H3,(H,23,24) |
| InChIKey | IVBRLHCZBZYQSY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|