C40H70O7 — CID 91219426
9-(2,5-dioxooxolan-3-yl)-11-octadec-12-en-9-ylperoxyoctadec-12-enoic acid (PubChem CID 91219426) has the molecular formula C40H70O7 and a molecular weight of 662.99 g/mol. Its IUPAC name is 9-(2,5-dioxooxolan-3-yl)-11-octadec-12-en-9-ylperoxyoctadec-12-enoic acid.
| Compound Name | 9-(2,5-dioxooxolan-3-yl)-11-octadec-12-en-9-ylperoxyoctadec-12-enoic acid |
|---|---|
| PubChem CID | 91219426 |
| Molecular Formula | C40H70O7 |
| Molecular Weight | 662.99 g/mol |
| Exact Mass | 662.51 |
| IUPAC Name | 9-(2,5-dioxooxolan-3-yl)-11-octadec-12-en-9-ylperoxyoctadec-12-enoic acid |
| SMILES | CCCCCC=CCCC(CCCCCCCC)OOC(C=CCCCCC)CC(CCCCCCCC(=O)O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C40H70O7/c1-4-7-10-13-15-20-24-29-35(28-23-19-14-11-8-5-2)46-47-36(30-25-17-12-9-6-3)32-34(37-33-39(43)45-40(37)44)27-22-18-16-21-26-31-38(41)42/h15,20,25,30,34-37H,4-14,16-19,21-24,26-29,31-33H2,1-3H3,(H,41,42) |
| InChIKey | BNRPTQLGLUGHOF-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.99 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|