C46H68O12 — CID 72559724
18-[17-carboxy-10-(2,5-dioxooxolan-3-yl)heptadec-6-en-8-yl]peroxy-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadecane-5-carboxylic acid (PubChem CID 72559724) has the molecular formula C46H68O12 and a molecular weight of 813.04 g/mol. Its IUPAC name is 18-[17-carboxy-10-(2,5-dioxooxolan-3-yl)heptadec-6-en-8-yl]peroxy-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadecane-5-carboxylic acid.
| Compound Name | 18-[17-carboxy-10-(2,5-dioxooxolan-3-yl)heptadec-6-en-8-yl]peroxy-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 72559724 |
| Molecular Formula | C46H68O12 |
| Molecular Weight | 813.04 g/mol |
| Exact Mass | 812.47 |
| IUPAC Name | 18-[17-carboxy-10-(2,5-dioxooxolan-3-yl)heptadec-6-en-8-yl]peroxy-5,9-dimethyl-14,16-dioxo-19-propan-2-yl-15-oxapentacyclo[10.5.2.01,10.04,9.013,17]nonadecane-5-carboxylic acid |
| SMILES | CCCCCC=CC(CC(CCCCCCCC(=O)O)C1CC(=O)OC1=O)OOC1C(C(C)C)C2CC3C4(C)CCCC(C)(C(=O)O)C4CCC13C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C46H68O12/c1-6-7-8-10-14-18-29(24-28(30-26-35(49)55-40(30)50)17-13-11-9-12-15-19-34(47)48)57-58-39-36(27(2)3)31-25-33-44(4)21-16-22-45(5,43(53)54)32(44)20-23-46(33,39)38-37(31)41(51)56-42(38)52/h14,18,27-33,36-39H,6-13,15-17,19-26H2,1-5H3,(H,47,48)(H,53,54) |
| InChIKey | WFUTXPLRSPJANP-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.04 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|