C47H70O10 — CID 138642643
18-[(E)-17-carboxy-6-(2,5-dioxooxolan-3-yl)heptadec-4-en-9-yl]-5,9-dimethyl-14,16-dioxo-20-propan-2-yl-15-oxapentacyclo[10.5.3.01,10.04,9.013,17]icosane-5-carboxylic acid (PubChem CID 138642643) has the molecular formula C47H70O10 and a molecular weight of 795.07 g/mol. Its IUPAC name is 18-[(E)-17-carboxy-6-(2,5-dioxooxolan-3-yl)heptadec-4-en-9-yl]-5,9-dimethyl-14,16-dioxo-20-propan-2-yl-15-oxapentacyclo[10.5.3.01,10.04,9.013,17]icosane-5-carboxylic acid.
| Compound Name | 18-[(E)-17-carboxy-6-(2,5-dioxooxolan-3-yl)heptadec-4-en-9-yl]-5,9-dimethyl-14,16-dioxo-20-propan-2-yl-15-oxapentacyclo[10.5.3.01,10.04,9.013,17]icosane-5-carboxylic acid |
|---|---|
| PubChem CID | 138642643 |
| Molecular Formula | C47H70O10 |
| Molecular Weight | 795.07 g/mol |
| Exact Mass | 794.50 |
| IUPAC Name | 18-[(E)-17-carboxy-6-(2,5-dioxooxolan-3-yl)heptadec-4-en-9-yl]-5,9-dimethyl-14,16-dioxo-20-propan-2-yl-15-oxapentacyclo[10.5.3.01,10.04,9.013,17]icosane-5-carboxylic acid |
| SMILES | CCC/C=C/C(CCC(CCCCCCCCC(=O)O)C1CC(C(C)C)C2CC3C4(C)CCCC(C)(C(=O)O)C4CCC13C1C(=O)OC(=O)C21)C1CC(=O)OC1=O |
| InChI | InChI=1S/C47H70O10/c1-6-7-12-16-29(32-27-38(50)56-41(32)51)19-20-30(17-13-10-8-9-11-14-18-37(48)49)34-25-31(28(2)3)33-26-36-45(4)22-15-23-46(5,44(54)55)35(45)21-24-47(34,36)40-39(33)42(52)57-43(40)53/h12,16,28-36,39-40H,6-11,13-15,17-27H2,1-5H3,(H,48,49)(H,54,55)/b16-12+ |
| InChIKey | GRXSGPMVJIOUQN-FOWTUZBSSA-N |
| XLogP | 9.57 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.07 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|