C26H40O4 — CID 176945788
3-[(7E,9Z)-18-cyclobutyl-18-oxooctadeca-7,9-dien-6-yl]oxolane-2,5-dione (PubChem CID 176945788) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 3-[(7E,9Z)-18-cyclobutyl-18-oxooctadeca-7,9-dien-6-yl]oxolane-2,5-dione.
| Compound Name | 3-[(7E,9Z)-18-cyclobutyl-18-oxooctadeca-7,9-dien-6-yl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 176945788 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 3-[(7E,9Z)-18-cyclobutyl-18-oxooctadeca-7,9-dien-6-yl]oxolane-2,5-dione |
| SMILES | CCCCCC(/C=C/C=C\CCCCCCCC(=O)C1CCC1)C1CC(=O)OC1=O |
| InChI | InChI=1S/C26H40O4/c1-2-3-11-15-21(23-20-25(28)30-26(23)29)16-12-9-7-5-4-6-8-10-13-19-24(27)22-17-14-18-22/h7,9,12,16,21-23H,2-6,8,10-11,13-15,17-20H2,1H3/b9-7-,16-12+ |
| InChIKey | VICPNUOGEYWZCP-KOLAHXGDSA-N |
| XLogP | 6.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|