C17H28O3 — CID 88684953
3-tridec-8-en-6-yloxolane-2,5-dione (PubChem CID 88684953) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 3-tridec-8-en-6-yloxolane-2,5-dione.
| Compound Name | 3-tridec-8-en-6-yloxolane-2,5-dione |
|---|---|
| PubChem CID | 88684953 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3-tridec-8-en-6-yloxolane-2,5-dione |
| SMILES | CCCCC=CCC(CCCCC)C1CC(=O)OC1=O |
| InChI | InChI=1S/C17H28O3/c1-3-5-7-8-10-12-14(11-9-6-4-2)15-13-16(18)20-17(15)19/h8,10,14-15H,3-7,9,11-13H2,1-2H3 |
| InChIKey | HDTXOMIVPXKFJC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|