C40H68O9 — CID 72526188
11-(1-carboxyheptadec-11-en-8-ylperoxy)-9-(2,5-dioxooxolan-3-yl)octadec-12-enoic acid (PubChem CID 72526188) has the molecular formula C40H68O9 and a molecular weight of 692.97 g/mol. Its IUPAC name is 11-(1-carboxyheptadec-11-en-8-ylperoxy)-9-(2,5-dioxooxolan-3-yl)octadec-12-enoic acid.
| Compound Name | 11-(1-carboxyheptadec-11-en-8-ylperoxy)-9-(2,5-dioxooxolan-3-yl)octadec-12-enoic acid |
|---|---|
| PubChem CID | 72526188 |
| Molecular Formula | C40H68O9 |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.49 |
| IUPAC Name | 11-(1-carboxyheptadec-11-en-8-ylperoxy)-9-(2,5-dioxooxolan-3-yl)octadec-12-enoic acid |
| SMILES | CCCCCC=CCCC(CCCCCCCC(=O)O)OOC(C=CCCCCC)CC(CCCCCCCC(=O)O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C40H68O9/c1-3-5-7-9-10-15-20-26-34(27-21-16-12-18-24-30-38(43)44)48-49-35(28-22-13-8-6-4-2)31-33(36-32-39(45)47-40(36)46)25-19-14-11-17-23-29-37(41)42/h10,15,22,28,33-36H,3-9,11-14,16-21,23-27,29-32H2,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | NIZRSYLGWRNPHH-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|