C15H22O4 — CID 123535147
3-(10-oxoundec-2-enyl)oxolane-2,5-dione (PubChem CID 123535147) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(10-oxoundec-2-enyl)oxolane-2,5-dione.
| Compound Name | 3-(10-oxoundec-2-enyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 123535147 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(10-oxoundec-2-enyl)oxolane-2,5-dione |
| SMILES | CC(=O)CCCCCCC=CCC1CC(=O)OC1=O |
| InChI | InChI=1S/C15H22O4/c1-12(16)9-7-5-3-2-4-6-8-10-13-11-14(17)19-15(13)18/h6,8,13H,2-5,7,9-11H2,1H3 |
| InChIKey | CZJFBCCUCSRBNY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|