C20H34O3 — CID 118424588
3-[(E)-2-hexyldec-2-enyl]oxolane-2,5-dione (PubChem CID 118424588) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-[(E)-2-hexyldec-2-enyl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-2-hexyldec-2-enyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 118424588 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 3-[(E)-2-hexyldec-2-enyl]oxolane-2,5-dione |
| SMILES | CCCCCCC/C=C(\CCCCCC)CC1CC(=O)OC1=O |
| InChI | InChI=1S/C20H34O3/c1-3-5-7-9-10-12-14-17(13-11-8-6-4-2)15-18-16-19(21)23-20(18)22/h14,18H,3-13,15-16H2,1-2H3/b17-14+ |
| InChIKey | MXSWJBZBDCVWEW-SAPNQHFASA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|