C19H24O3 — CID 12895833
3-[(2E,5E,8E,11E)-pentadeca-2,5,8,11,14-pentaenyl]oxolane-2,5-dione (PubChem CID 12895833) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[(2E,5E,8E,11E)-pentadeca-2,5,8,11,14-pentaenyl]oxolane-2,5-dione.
| Compound Name | 3-[(2E,5E,8E,11E)-pentadeca-2,5,8,11,14-pentaenyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 12895833 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 3-[(2E,5E,8E,11E)-pentadeca-2,5,8,11,14-pentaenyl]oxolane-2,5-dione |
| SMILES | C=CC/C=C/C/C=C/C/C=C/C/C=C/CC1CC(=O)OC1=O |
| InChI | InChI=1S/C19H24O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-16-18(20)22-19(17)21/h2,4-5,7-8,10-11,13-14,17H,1,3,6,9,12,15-16H2/b5-4+,8-7+,11-10+,14-13+ |
| InChIKey | UPQKWIWFMQREJI-ARQYDCTJSA-N |
| XLogP | 4.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|