C11H12O7 — CID 174972510
3-hydroxyoxolane-2,5-dione;3-prop-2-enyloxolane-2,5-dione (PubChem CID 174972510) has the molecular formula C11H12O7 and a molecular weight of 256.21 g/mol. Its IUPAC name is 3-hydroxyoxolane-2,5-dione;3-prop-2-enyloxolane-2,5-dione.
| Compound Name | 3-hydroxyoxolane-2,5-dione;3-prop-2-enyloxolane-2,5-dione |
|---|---|
| PubChem CID | 174972510 |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-hydroxyoxolane-2,5-dione;3-prop-2-enyloxolane-2,5-dione |
| SMILES | C=CCC1CC(=O)OC1=O.O=C1CC(O)C(=O)O1 |
| InChI | InChI=1S/C7H8O3.C4H4O4/c1-2-3-5-4-6(8)10-7(5)9;5-2-1-3(6)8-4(2)7/h2,5H,1,3-4H2;2,5H,1H2 |
| InChIKey | MHOZPHVRSQGRHN-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|