C10H18O3Si — CID 59938370
3-(2-trimethylsilylpropyl)oxolane-2,5-dione (PubChem CID 59938370) has the molecular formula C10H18O3Si and a molecular weight of 214.34 g/mol. Its IUPAC name is 3-(2-trimethylsilylpropyl)oxolane-2,5-dione.
| Compound Name | 3-(2-trimethylsilylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 59938370 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-(2-trimethylsilylpropyl)oxolane-2,5-dione |
| SMILES | CC(CC1CC(=O)OC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O3Si/c1-7(14(2,3)4)5-8-6-9(11)13-10(8)12/h7-8H,5-6H2,1-4H3 |
| InChIKey | PRXIXASSQHDXNV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|