About 3-octa-2,4-dienyloxolane-2,5-dione
3-octa-2,4-dienyloxolane-2,5-dione (PubChem CID 153403981) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-octa-2,4-dienyloxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-octa-2,4-dienyloxolane-2,5-dione |
| PubChem CID | 153403981 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-octa-2,4-dienyloxolane-2,5-dione |
| SMILES | CCCC=CC=CCC1CC(=O)OC1=O |
| InChI | InChI=1S/C12H16O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | WHJFWHNCVBPWSC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-octa-2,4-dienyloxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octa-2,4-dienyloxolane-2,5-dione?
The IUPAC name of 3-octa-2,4-dienyloxolane-2,5-dione (CID 153403981) is 3-octa-2,4-dienyloxolane-2,5-dione.
What is the SMILES notation for 3-octa-2,4-dienyloxolane-2,5-dione?
The canonical SMILES for 3-octa-2,4-dienyloxolane-2,5-dione is CCCC=CC=CCC1CC(=O)OC1=O.
What is the InChIKey of 3-octa-2,4-dienyloxolane-2,5-dione?
The InChIKey is WHJFWHNCVBPWSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h4-7,10H,2-3,8-9H2,1H3.
What are the key properties of 3-octa-2,4-dienyloxolane-2,5-dione?
3-octa-2,4-dienyloxolane-2,5-dione has a molecular weight of 208.26 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octa-2,4-dienyloxolane-2,5-dione is sourced from PubChem (CID 153403981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).