C9H12O4Si — CID 90159814
3-[(E)-4-[methyl(oxo)silyl]but-2-enyl]oxolane-2,5-dione (PubChem CID 90159814) has the molecular formula C9H12O4Si and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-[(E)-4-[methyl(oxo)silyl]but-2-enyl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-4-[methyl(oxo)silyl]but-2-enyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 90159814 |
| Molecular Formula | C9H12O4Si |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 3-[(E)-4-[methyl(oxo)silyl]but-2-enyl]oxolane-2,5-dione |
| SMILES | C[Si](=O)C/C=C/CC1CC(=O)OC1=O |
| InChI | InChI=1S/C9H12O4Si/c1-14(12)5-3-2-4-7-6-8(10)13-9(7)11/h2-3,7H,4-6H2,1H3/b3-2+ |
| InChIKey | YXWZOGMHTUDKFH-NSCUHMNNSA-N |
| XLogP | 1.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|