C15H18O10 — CID 173313734
ethenyl acetate;3-hydroxyoxolane-2,5-dione;4-oxo-4-prop-2-enoxybut-2-enoic acid (PubChem CID 173313734) has the molecular formula C15H18O10 and a molecular weight of 358.30 g/mol. Its IUPAC name is ethenyl acetate;3-hydroxyoxolane-2,5-dione;4-oxo-4-prop-2-enoxybut-2-enoic acid.
| Compound Name | ethenyl acetate;3-hydroxyoxolane-2,5-dione;4-oxo-4-prop-2-enoxybut-2-enoic acid |
|---|---|
| PubChem CID | 173313734 |
| Molecular Formula | C15H18O10 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | ethenyl acetate;3-hydroxyoxolane-2,5-dione;4-oxo-4-prop-2-enoxybut-2-enoic acid |
| SMILES | C=CCOC(=O)C=CC(=O)O.C=COC(C)=O.O=C1CC(O)C(=O)O1 |
| InChI | InChI=1S/C7H8O4.C4H4O4.C4H6O2/c1-2-5-11-7(10)4-3-6(8)9;5-2-1-3(6)8-4(2)7;1-3-6-4(2)5/h2-4H,1,5H2,(H,8,9);2,5H,1H2;3H,1H2,2H3 |
| InChIKey | UNKIMJBPOFAIPN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|