C4H4O4 — CID 118327209
(3R)-3-hydroxyoxolane-2,5-dione (PubChem CID 118327209) has the molecular formula C4H4O4 and a molecular weight of 116.07 g/mol. Its IUPAC name is (3R)-3-hydroxyoxolane-2,5-dione.
| Compound Name | (3R)-3-hydroxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 118327209 |
| Molecular Formula | C4H4O4 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | (3R)-3-hydroxyoxolane-2,5-dione |
| SMILES | O=C1C[C@@H](O)C(=O)O1 |
| InChI | InChI=1S/C4H4O4/c5-2-1-3(6)8-4(2)7/h2,5H,1H2/t2-/m1/s1 |
| InChIKey | KPYCVQASEGGKEG-UWTATZPHSA-N |
| XLogP | -1.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|