About (3S)-3-aminooxolane-2,5-dione;zinc
(3S)-3-aminooxolane-2,5-dione;zinc (PubChem CID 174884876) has the molecular formula C4H5NO3Zn
and a molecular weight of 180.48 g/mol. Its IUPAC name is (3S)-3-aminooxolane-2,5-dione;zinc.
Molecular Properties
| Compound Name | (3S)-3-aminooxolane-2,5-dione;zinc |
| PubChem CID | 174884876 |
| Molecular Formula | C4H5NO3Zn |
| Molecular Weight | 180.48 g/mol |
| Exact Mass | 178.96 |
| IUPAC Name | (3S)-3-aminooxolane-2,5-dione;zinc |
| SMILES | N[C@H]1CC(=O)OC1=O.[Zn] |
| InChI | InChI=1S/C4H5NO3.Zn/c5-2-1-3(6)8-4(2)7;/h2H,1,5H2;/t2-;/m0./s1 |
| InChIKey | AQBSNUCWNCUWBL-DKWTVANSSA-N |
| XLogP | -1.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.48 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-aminooxolane-2,5-dione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminooxolane-2,5-dione;zinc?
The IUPAC name of (3S)-3-aminooxolane-2,5-dione;zinc (CID 174884876) is (3S)-3-aminooxolane-2,5-dione;zinc.
What is the SMILES notation for (3S)-3-aminooxolane-2,5-dione;zinc?
The canonical SMILES for (3S)-3-aminooxolane-2,5-dione;zinc is N[C@H]1CC(=O)OC1=O.[Zn].
What is the InChIKey of (3S)-3-aminooxolane-2,5-dione;zinc?
The InChIKey is AQBSNUCWNCUWBL-DKWTVANSSA-N. The full InChI is InChI=1S/C4H5NO3.Zn/c5-2-1-3(6)8-4(2)7;/h2H,1,5H2;/t2-;/m0./s1.
What are the key properties of (3S)-3-aminooxolane-2,5-dione;zinc?
(3S)-3-aminooxolane-2,5-dione;zinc has a molecular weight of 180.48 g/mol, XLogP of -1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminooxolane-2,5-dione;zinc is sourced from PubChem (CID 174884876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).