C8H6O7 — CID 59141604
3-(2,5-dioxooxolan-3-yl)oxyoxolane-2,5-dione (PubChem CID 59141604) has the molecular formula C8H6O7 and a molecular weight of 214.13 g/mol. Its IUPAC name is 3-(2,5-dioxooxolan-3-yl)oxyoxolane-2,5-dione.
| Compound Name | 3-(2,5-dioxooxolan-3-yl)oxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 59141604 |
| Molecular Formula | C8H6O7 |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3-(2,5-dioxooxolan-3-yl)oxyoxolane-2,5-dione |
| SMILES | O=C1CC(OC2CC(=O)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C8H6O7/c9-5-1-3(7(11)14-5)13-4-2-6(10)15-8(4)12/h3-4H,1-2H2 |
| InChIKey | PEBJIJMTKBXUIA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|