C8H7AlO8 — CID 149321706
3-(2,5-dioxooxolan-3-yl)oxyalumanyloxyoxolane-2,5-dione (PubChem CID 149321706) has the molecular formula C8H7AlO8 and a molecular weight of 258.12 g/mol. Its IUPAC name is 3-(2,5-dioxooxolan-3-yl)oxyalumanyloxyoxolane-2,5-dione.
| Compound Name | 3-(2,5-dioxooxolan-3-yl)oxyalumanyloxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 149321706 |
| Molecular Formula | C8H7AlO8 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-(2,5-dioxooxolan-3-yl)oxyalumanyloxyoxolane-2,5-dione |
| SMILES | O=C1CC(O[AlH]OC2CC(=O)OC2=O)C(=O)O1 |
| InChI | InChI=1S/2C4H3O4.Al.H/c2*5-2-1-3(6)8-4(2)7;;/h2*2H,1H2;;/q2*-1;+2; |
| InChIKey | YAPCAVNZBNQFTM-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|