C7H6O6 — CID 130182023
acetyl 2,5-dioxooxolane-3-carboxylate (PubChem CID 130182023) has the molecular formula C7H6O6 and a molecular weight of 186.12 g/mol. Its IUPAC name is acetyl 2,5-dioxooxolane-3-carboxylate.
| Compound Name | acetyl 2,5-dioxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 130182023 |
| Molecular Formula | C7H6O6 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | acetyl 2,5-dioxooxolane-3-carboxylate |
| SMILES | CC(=O)OC(=O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C7H6O6/c1-3(8)12-6(10)4-2-5(9)13-7(4)11/h4H,2H2,1H3 |
| InChIKey | BQAIIFQKKOEMNJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|