C7H6O4 — CID 154281249
3-prop-2-enoyloxolane-2,5-dione (PubChem CID 154281249) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 3-prop-2-enoyloxolane-2,5-dione.
| Compound Name | 3-prop-2-enoyloxolane-2,5-dione |
|---|---|
| PubChem CID | 154281249 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 3-prop-2-enoyloxolane-2,5-dione |
| SMILES | C=CC(=O)C1CC(=O)OC1=O |
| InChI | InChI=1S/C7H6O4/c1-2-5(8)4-3-6(9)11-7(4)10/h2,4H,1,3H2 |
| InChIKey | MOGSQDSSYGEPFK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|