C11H14O6 — CID 134242126
3-(2,5-dioxooxolan-3-yl)oxybutyl prop-2-enoate (PubChem CID 134242126) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-(2,5-dioxooxolan-3-yl)oxybutyl prop-2-enoate.
| Compound Name | 3-(2,5-dioxooxolan-3-yl)oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 134242126 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(2,5-dioxooxolan-3-yl)oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(C)OC1CC(=O)OC1=O |
| InChI | InChI=1S/C11H14O6/c1-3-9(12)15-5-4-7(2)16-8-6-10(13)17-11(8)14/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | VTHGCYFVQKKBJJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|