C12H10O5 — CID 98078095
[4-[(3S)-2,5-dioxooxolan-3-yl]phenyl] acetate (PubChem CID 98078095) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is [4-[(3S)-2,5-dioxooxolan-3-yl]phenyl] acetate.
| Compound Name | [4-[(3S)-2,5-dioxooxolan-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 98078095 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [4-[(3S)-2,5-dioxooxolan-3-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2CC(=O)OC2=O)cc1 |
| InChI | InChI=1S/C12H10O5/c1-7(13)16-9-4-2-8(3-5-9)10-6-11(14)17-12(10)15/h2-5,10H,6H2,1H3/t10-/m0/s1 |
| InChIKey | ABMHHGRAKIODFS-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|