C11H10O5 — CID 125491560
[4-[(4S)-2-oxo-1,3-dioxolan-4-yl]phenyl] acetate (PubChem CID 125491560) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is [4-[(4S)-2-oxo-1,3-dioxolan-4-yl]phenyl] acetate.
| Compound Name | [4-[(4S)-2-oxo-1,3-dioxolan-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 125491560 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | [4-[(4S)-2-oxo-1,3-dioxolan-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H]2COC(=O)O2)cc1 |
| InChI | InChI=1S/C11H10O5/c1-7(12)15-9-4-2-8(3-5-9)10-6-14-11(13)16-10/h2-5,10H,6H2,1H3/t10-/m1/s1 |
| InChIKey | IILQVHVDBDWYKU-SNVBAGLBSA-N |
| XLogP | 1.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|