C22H20O4 — CID 163755191
[4-[6-[(Z)-but-1-en-3-ynyl]-5-methyl-2-oxo-3,4,7,8-tetrahydrochromen-4-yl]phenyl] acetate (PubChem CID 163755191) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [4-[6-[(Z)-but-1-en-3-ynyl]-5-methyl-2-oxo-3,4,7,8-tetrahydrochromen-4-yl]phenyl] acetate.
| Compound Name | [4-[6-[(Z)-but-1-en-3-ynyl]-5-methyl-2-oxo-3,4,7,8-tetrahydrochromen-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 163755191 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [4-[6-[(Z)-but-1-en-3-ynyl]-5-methyl-2-oxo-3,4,7,8-tetrahydrochromen-4-yl]phenyl] acetate |
| SMILES | C#C/C=C\C1=C(C)C2=C(CC1)OC(=O)CC2c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C22H20O4/c1-4-5-6-16-9-12-20-22(14(16)2)19(13-21(24)26-20)17-7-10-18(11-8-17)25-15(3)23/h1,5-8,10-11,19H,9,12-13H2,2-3H3/b6-5- |
| InChIKey | LTLQUJVJNXEJQH-WAYWQWQTSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|