C10H14O6S — CID 88706637
1,4-dioxane;S-(2,5-dioxooxolan-3-yl) ethanethioate (PubChem CID 88706637) has the molecular formula C10H14O6S and a molecular weight of 262.28 g/mol. Its IUPAC name is 1,4-dioxane;S-(2,5-dioxooxolan-3-yl) ethanethioate.
| Compound Name | 1,4-dioxane;S-(2,5-dioxooxolan-3-yl) ethanethioate |
|---|---|
| PubChem CID | 88706637 |
| Molecular Formula | C10H14O6S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1,4-dioxane;S-(2,5-dioxooxolan-3-yl) ethanethioate |
| SMILES | C1COCCO1.CC(=O)SC1CC(=O)OC1=O |
| InChI | InChI=1S/C6H6O4S.C4H8O2/c1-3(7)11-4-2-5(8)10-6(4)9;1-2-6-4-3-5-1/h4H,2H2,1H3;1-4H2 |
| InChIKey | SYHHKRXJYLWAIN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|