C7H6O5 — CID 19379709
3-acetyloxane-2,4,6-trione (PubChem CID 19379709) has the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. Its IUPAC name is 3-acetyloxane-2,4,6-trione.
| Compound Name | 3-acetyloxane-2,4,6-trione |
|---|---|
| PubChem CID | 19379709 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 3-acetyloxane-2,4,6-trione |
| SMILES | CC(=O)C1C(=O)CC(=O)OC1=O |
| InChI | InChI=1S/C7H6O5/c1-3(8)6-4(9)2-5(10)12-7(6)11/h6H,2H2,1H3 |
| InChIKey | ULYBDHWPSNRFNP-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|