C12H12O6 — CID 174916587
2,2,4-triacetylcyclohexane-1,3,5-trione (PubChem CID 174916587) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2,2,4-triacetylcyclohexane-1,3,5-trione.
| Compound Name | 2,2,4-triacetylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 174916587 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2,2,4-triacetylcyclohexane-1,3,5-trione |
| SMILES | CC(=O)C1C(=O)CC(=O)C(C(C)=O)(C(C)=O)C1=O |
| InChI | InChI=1S/C12H12O6/c1-5(13)10-8(16)4-9(17)12(6(2)14,7(3)15)11(10)18/h10H,4H2,1-3H3 |
| InChIKey | RTVBLDRMIPCUEZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|