C6H7NO3 — CID 906297
(3S)-3-acetylpyrrolidine-2,4-dione (PubChem CID 906297) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is (3S)-3-acetylpyrrolidine-2,4-dione.
| Compound Name | (3S)-3-acetylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 906297 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | (3S)-3-acetylpyrrolidine-2,4-dione |
| SMILES | CC(=O)[C@H]1C(=O)CNC1=O |
| InChI | InChI=1S/C6H7NO3/c1-3(8)5-4(9)2-7-6(5)10/h5H,2H2,1H3,(H,7,10)/t5-/m0/s1 |
| InChIKey | KBEZSONORPLPSB-YFKPBYRVSA-N |
| XLogP | -1.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|