C10H16N2O3 — CID 163940017
N-(2,4-dioxopyrrolidin-3-yl)hexanamide (PubChem CID 163940017) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-(2,4-dioxopyrrolidin-3-yl)hexanamide.
| Compound Name | N-(2,4-dioxopyrrolidin-3-yl)hexanamide |
|---|---|
| PubChem CID | 163940017 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-(2,4-dioxopyrrolidin-3-yl)hexanamide |
| SMILES | CCCCCC(=O)NC1C(=O)CNC1=O |
| InChI | InChI=1S/C10H16N2O3/c1-2-3-4-5-8(14)12-9-7(13)6-11-10(9)15/h9H,2-6H2,1H3,(H,11,15)(H,12,14) |
| InChIKey | RQEMYOBFOVEJIQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|