3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid

C8H8O5 — CID 88781055

IUPAC3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid
SMILESCC(=O)C1C(=O)CC(C(=O)O)C1=O
InChIInChI=1S/C8H8O5/c1-3(9)6-5(10)2-4(7(6)11)8(12)13/h4,6H,2H2,1H3,(H,12,13)
InChIKeyHKQUDZSPTNRWPN-UHFFFAOYSA-N
MW184.15 g/mol
LogP-0.57
Rot. Bonds2

About 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid

3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid (PubChem CID 88781055) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid
PubChem CID88781055
Molecular FormulaC8H8O5
Molecular Weight184.15 g/mol
Exact Mass184.04
IUPAC Name3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid
SMILESCC(=O)C1C(=O)CC(C(=O)O)C1=O
InChIInChI=1S/C8H8O5/c1-3(9)6-5(10)2-4(7(6)11)8(12)13/h4,6H,2H2,1H3,(H,12,13)
InChIKeyHKQUDZSPTNRWPN-UHFFFAOYSA-N
XLogP-0.57
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid?
The IUPAC name of 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid (CID 88781055) is 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid?
The canonical SMILES for 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid is CC(=O)C1C(=O)CC(C(=O)O)C1=O.
What is the InChIKey of 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid?
The InChIKey is HKQUDZSPTNRWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5/c1-3(9)6-5(10)2-4(7(6)11)8(12)13/h4,6H,2H2,1H3,(H,12,13).
What are the key properties of 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid?
3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of -0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2,4-dioxocyclopentane-1-carboxylic acid is sourced from PubChem (CID 88781055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).