C16H16O5 — CID 792850
methyl (1S,3S,6S)-3-acetyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate (PubChem CID 792850) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl (1S,3S,6S)-3-acetyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,6S)-3-acetyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 792850 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl (1S,3S,6S)-3-acetyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@@H](C(C)=O)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16O5/c1-9(17)13-12(18)8-11(10-6-4-3-5-7-10)14(15(13)19)16(20)21-2/h3-7,11,13-14H,8H2,1-2H3/t11-,13+,14+/m1/s1 |
| InChIKey | WOEWRLOEFTXBAJ-XBFCOCLRSA-N |
| XLogP | 1.31 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|