C20H17ClO4S — CID 98161938
methyl (1R,3S,6S)-3-(4-chlorophenyl)sulfanyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate (PubChem CID 98161938) has the molecular formula C20H17ClO4S and a molecular weight of 388.87 g/mol. Its IUPAC name is methyl (1R,3S,6S)-3-(4-chlorophenyl)sulfanyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3S,6S)-3-(4-chlorophenyl)sulfanyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 98161938 |
| Molecular Formula | C20H17ClO4S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | methyl (1R,3S,6S)-3-(4-chlorophenyl)sulfanyl-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)[C@@H](Sc2ccc(Cl)cc2)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H17ClO4S/c1-25-20(24)17-15(12-5-3-2-4-6-12)11-16(22)19(18(17)23)26-14-9-7-13(21)8-10-14/h2-10,15,17,19H,11H2,1H3/t15-,17-,19+/m1/s1 |
| InChIKey | GDCAUZKTHGMTTM-SUMDDJOVSA-N |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|