C22H18ClNO7 — CID 19898289
ethyl 3-(4-chloro-2-nitrobenzoyl)-2,4-dioxo-6-phenylcyclohexane-1-carboxylate (PubChem CID 19898289) has the molecular formula C22H18ClNO7 and a molecular weight of 443.84 g/mol. Its IUPAC name is ethyl 3-(4-chloro-2-nitrobenzoyl)-2,4-dioxo-6-phenylcyclohexane-1-carboxylate.
| Compound Name | ethyl 3-(4-chloro-2-nitrobenzoyl)-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19898289 |
| Molecular Formula | C22H18ClNO7 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | ethyl 3-(4-chloro-2-nitrobenzoyl)-2,4-dioxo-6-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C22H18ClNO7/c1-2-31-22(28)18-15(12-6-4-3-5-7-12)11-17(25)19(21(18)27)20(26)14-9-8-13(23)10-16(14)24(29)30/h3-10,15,18-19H,2,11H2,1H3 |
| InChIKey | LNNXOKJZMSGEAH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|