C15H15ClN2O5 — CID 19898156
3-(4-chloro-2-nitrobenzoyl)-1,5,5-trimethylpiperidine-2,4-dione (PubChem CID 19898156) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrobenzoyl)-1,5,5-trimethylpiperidine-2,4-dione.
| Compound Name | 3-(4-chloro-2-nitrobenzoyl)-1,5,5-trimethylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 19898156 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-(4-chloro-2-nitrobenzoyl)-1,5,5-trimethylpiperidine-2,4-dione |
| SMILES | CN1CC(C)(C)C(=O)C(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C15H15ClN2O5/c1-15(2)7-17(3)14(21)11(13(15)20)12(19)9-5-4-8(16)6-10(9)18(22)23/h4-6,11H,7H2,1-3H3 |
| InChIKey | NTIYSHGGCIRRIQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|