C15H14F2N2O6 — CID 155227707
(5S)-5-(2,5-difluoro-4-nitrobenzoyl)-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid (PubChem CID 155227707) has the molecular formula C15H14F2N2O6 and a molecular weight of 356.28 g/mol. Its IUPAC name is (5S)-5-(2,5-difluoro-4-nitrobenzoyl)-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid.
| Compound Name | (5S)-5-(2,5-difluoro-4-nitrobenzoyl)-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155227707 |
| Molecular Formula | C15H14F2N2O6 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (5S)-5-(2,5-difluoro-4-nitrobenzoyl)-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)O)C[C@H](C(=O)c2cc(F)c([N+](=O)[O-])cc2F)C1=O |
| InChI | InChI=1S/C15H14F2N2O6/c1-15(2)6-18(14(22)23)5-8(13(15)21)12(20)7-3-10(17)11(19(24)25)4-9(7)16/h3-4,8H,5-6H2,1-2H3,(H,22,23)/t8-/m1/s1 |
| InChIKey | UDIREGMHWVAYRF-MRVPVSSYSA-N |
| XLogP | 2.26 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|