C14H16F2N2O3 — CID 115874347
(2,5-difluoro-4-nitrophenyl)-(3,4-dimethylpiperidin-1-yl)methanone (PubChem CID 115874347) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is (2,5-difluoro-4-nitrophenyl)-(3,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | (2,5-difluoro-4-nitrophenyl)-(3,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 115874347 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2,5-difluoro-4-nitrophenyl)-(3,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(F)c([N+](=O)[O-])cc2F)CC1C |
| InChI | InChI=1S/C14H16F2N2O3/c1-8-3-4-17(7-9(8)2)14(19)10-5-12(16)13(18(20)21)6-11(10)15/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | GJCDRQLXWJIJFI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|