C15H19FN2O3 — CID 103297610
(3,4-dimethylpiperidin-1-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone (PubChem CID 103297610) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is (3,4-dimethylpiperidin-1-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone.
| Compound Name | (3,4-dimethylpiperidin-1-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 103297610 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3,4-dimethylpiperidin-1-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)N2CCC(C)C(C)C2)c1F |
| InChI | InChI=1S/C15H19FN2O3/c1-9-4-5-17(8-11(9)3)15(19)13-7-12(18(20)21)6-10(2)14(13)16/h6-7,9,11H,4-5,8H2,1-3H3 |
| InChIKey | GNVSGLZAHKVISU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|