C14H17FN2O4 — CID 103297173
(2,2-dimethylmorpholin-4-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone (PubChem CID 103297173) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is (2,2-dimethylmorpholin-4-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone.
| Compound Name | (2,2-dimethylmorpholin-4-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 103297173 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2,2-dimethylmorpholin-4-yl)-(2-fluoro-3-methyl-5-nitrophenyl)methanone |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)N2CCOC(C)(C)C2)c1F |
| InChI | InChI=1S/C14H17FN2O4/c1-9-6-10(17(19)20)7-11(12(9)15)13(18)16-4-5-21-14(2,3)8-16/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | JPEIRBOIQSXKAH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|