C13H13ClF2N2O3 — CID 107123572
(3-chloro-4-methylpiperidin-1-yl)-(2,5-difluoro-3-nitrophenyl)methanone (PubChem CID 107123572) has the molecular formula C13H13ClF2N2O3 and a molecular weight of 318.71 g/mol. Its IUPAC name is (3-chloro-4-methylpiperidin-1-yl)-(2,5-difluoro-3-nitrophenyl)methanone.
| Compound Name | (3-chloro-4-methylpiperidin-1-yl)-(2,5-difluoro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 107123572 |
| Molecular Formula | C13H13ClF2N2O3 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (3-chloro-4-methylpiperidin-1-yl)-(2,5-difluoro-3-nitrophenyl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(F)cc([N+](=O)[O-])c2F)CC1Cl |
| InChI | InChI=1S/C13H13ClF2N2O3/c1-7-2-3-17(6-10(7)14)13(19)9-4-8(15)5-11(12(9)16)18(20)21/h4-5,7,10H,2-3,6H2,1H3 |
| InChIKey | KXRCXWGWGDALGI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|