C13H13F3N2O3 — CID 110317049
(3-methylpiperidin-1-yl)-(2,3,4-trifluoro-5-nitrophenyl)methanone (PubChem CID 110317049) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-(2,3,4-trifluoro-5-nitrophenyl)methanone.
| Compound Name | (3-methylpiperidin-1-yl)-(2,3,4-trifluoro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 110317049 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3-methylpiperidin-1-yl)-(2,3,4-trifluoro-5-nitrophenyl)methanone |
| SMILES | CC1CCCN(C(=O)c2cc([N+](=O)[O-])c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C13H13F3N2O3/c1-7-3-2-4-17(6-7)13(19)8-5-9(18(20)21)11(15)12(16)10(8)14/h5,7H,2-4,6H2,1H3 |
| InChIKey | JSEFFHMIVRRDRI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|