C21H20ClNO7 — CID 54420836
2-(4-chloro-2-nitrobenzoyl)-4-(2,4-dioxocycloheptyl)cycloheptane-1,3-dione (PubChem CID 54420836) has the molecular formula C21H20ClNO7 and a molecular weight of 433.84 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrobenzoyl)-4-(2,4-dioxocycloheptyl)cycloheptane-1,3-dione.
| Compound Name | 2-(4-chloro-2-nitrobenzoyl)-4-(2,4-dioxocycloheptyl)cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 54420836 |
| Molecular Formula | C21H20ClNO7 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-(4-chloro-2-nitrobenzoyl)-4-(2,4-dioxocycloheptyl)cycloheptane-1,3-dione |
| SMILES | O=C1CCCC(C2CCCC(=O)C(C(=O)c3ccc(Cl)cc3[N+](=O)[O-])C2=O)C(=O)C1 |
| InChI | InChI=1S/C21H20ClNO7/c22-11-7-8-15(16(9-11)23(29)30)21(28)19-17(25)6-2-5-14(20(19)27)13-4-1-3-12(24)10-18(13)26/h7-9,13-14,19H,1-6,10H2 |
| InChIKey | WARNBOWMISAUHV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 128.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|