C20H17ClN2O5S — CID 19898214
3-(4-chloro-2-nitrobenzoyl)-1-methyl-6-(4-methylsulfanylphenyl)piperidine-2,4-dione (PubChem CID 19898214) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrobenzoyl)-1-methyl-6-(4-methylsulfanylphenyl)piperidine-2,4-dione.
| Compound Name | 3-(4-chloro-2-nitrobenzoyl)-1-methyl-6-(4-methylsulfanylphenyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 19898214 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(4-chloro-2-nitrobenzoyl)-1-methyl-6-(4-methylsulfanylphenyl)piperidine-2,4-dione |
| SMILES | CSc1ccc(C2CC(=O)C(C(=O)c3ccc(Cl)cc3[N+](=O)[O-])C(=O)N2C)cc1 |
| InChI | InChI=1S/C20H17ClN2O5S/c1-22-15(11-3-6-13(29-2)7-4-11)10-17(24)18(20(22)26)19(25)14-8-5-12(21)9-16(14)23(27)28/h3-9,15,18H,10H2,1-2H3 |
| InChIKey | IRMRQFVLXWSACU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|