C21H21ClO4 — CID 3736836
ethyl 4-(4-chlorophenyl)-4-hydroxy-2-oxo-6-phenylcyclohexane-1-carboxylate (PubChem CID 3736836) has the molecular formula C21H21ClO4 and a molecular weight of 372.85 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-4-hydroxy-2-oxo-6-phenylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-4-hydroxy-2-oxo-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3736836 |
| Molecular Formula | C21H21ClO4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-4-hydroxy-2-oxo-6-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(O)(c2ccc(Cl)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C21H21ClO4/c1-2-26-20(24)19-17(14-6-4-3-5-7-14)12-21(25,13-18(19)23)15-8-10-16(22)11-9-15/h3-11,17,19,25H,2,12-13H2,1H3 |
| InChIKey | DDDMZQZGOCQJOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|