C17H17Cl2NO6 — CID 88544972
ethyl 2-(2,2-dichloroethenyl)-4-hydroxy-4-(4-nitrophenyl)-6-oxocyclohexane-1-carboxylate (PubChem CID 88544972) has the molecular formula C17H17Cl2NO6 and a molecular weight of 402.23 g/mol. Its IUPAC name is ethyl 2-(2,2-dichloroethenyl)-4-hydroxy-4-(4-nitrophenyl)-6-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 2-(2,2-dichloroethenyl)-4-hydroxy-4-(4-nitrophenyl)-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88544972 |
| Molecular Formula | C17H17Cl2NO6 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | ethyl 2-(2,2-dichloroethenyl)-4-hydroxy-4-(4-nitrophenyl)-6-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(O)(c2ccc([N+](=O)[O-])cc2)CC1C=C(Cl)Cl |
| InChI | InChI=1S/C17H17Cl2NO6/c1-2-26-16(22)15-10(7-14(18)19)8-17(23,9-13(15)21)11-3-5-12(6-4-11)20(24)25/h3-7,10,15,23H,2,8-9H2,1H3 |
| InChIKey | JOTOJFYGODUESK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|